C32H42N4O7S — CID 18009099
[1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid (PubChem CID 18009099) has the molecular formula C32H42N4O7S and a molecular weight of 626.78 g/mol. Its IUPAC name is [1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 18009099 |
| Molecular Formula | C32H42N4O7S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | [1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid |
| SMILES | COc1ccc(-c2ccccc2CC(NC(=O)O)C(=O)NCCCC(CO)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C32H42N4O7S/c1-22(2)20-36(44(41,42)28-16-12-25(33)13-17-28)26(21-37)8-6-18-34-31(38)30(35-32(39)40)19-24-7-4-5-9-29(24)23-10-14-27(43-3)15-11-23/h4-5,7,9-17,22,26,30,35,37H,6,8,18-21,33H2,1-3H3,(H,34,38)(H,39,40) |
| InChIKey | MKKHCIUYWJWJTF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|