C33H44N4O7S — CID 18009071
[1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid (PubChem CID 18009071) has the molecular formula C33H44N4O7S and a molecular weight of 640.80 g/mol. Its IUPAC name is [1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 18009071 |
| Molecular Formula | C33H44N4O7S |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | [1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamic acid |
| SMILES | COc1ccc(-c2ccccc2CC(NC(=O)O)C(=O)NCCCCC(CO)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C33H44N4O7S/c1-23(2)21-37(45(42,43)29-17-13-26(34)14-18-29)27(22-38)9-6-7-19-35-32(39)31(36-33(40)41)20-25-8-4-5-10-30(25)24-11-15-28(44-3)16-12-24/h4-5,8,10-18,23,27,31,36,38H,6-7,9,19-22,34H2,1-3H3,(H,35,39)(H,40,41) |
| InChIKey | AHVONVUJJDZYTI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|