C32H44N4O4S — CID 513775
1-[(4-aminophenyl)methyl]-1-benzyl-3-[(5S)-6-hydroxy-5-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexyl]urea (PubChem CID 513775) has the molecular formula C32H44N4O4S and a molecular weight of 580.80 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]-1-benzyl-3-[(5S)-6-hydroxy-5-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexyl]urea.
| Compound Name | 1-[(4-aminophenyl)methyl]-1-benzyl-3-[(5S)-6-hydroxy-5-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexyl]urea |
|---|---|
| PubChem CID | 513775 |
| Molecular Formula | C32H44N4O4S |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]-1-benzyl-3-[(5S)-6-hydroxy-5-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(C)C)[C@H](CO)CCCCNC(=O)N(Cc2ccccc2)Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C32H44N4O4S/c1-25(2)21-36(41(39,40)31-18-12-26(3)13-19-31)30(24-37)11-7-8-20-34-32(38)35(22-27-9-5-4-6-10-27)23-28-14-16-29(33)17-15-28/h4-6,9-10,12-19,25,30,37H,7-8,11,20-24,33H2,1-3H3,(H,34,38)/t30-/m0/s1 |
| InChIKey | UCHOQOBKLMPPAB-PMERELPUSA-N |
| XLogP | 5.17 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|