C31H40N4O5S — CID 18009064
3-[(4-aminophenyl)sulfonyl-[6-(3,3-diphenylpropanoylamino)-1-hydroxyhexan-2-yl]amino]-2-methylpropanamide (PubChem CID 18009064) has the molecular formula C31H40N4O5S and a molecular weight of 580.75 g/mol. Its IUPAC name is 3-[(4-aminophenyl)sulfonyl-[6-(3,3-diphenylpropanoylamino)-1-hydroxyhexan-2-yl]amino]-2-methylpropanamide.
| Compound Name | 3-[(4-aminophenyl)sulfonyl-[6-(3,3-diphenylpropanoylamino)-1-hydroxyhexan-2-yl]amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 18009064 |
| Molecular Formula | C31H40N4O5S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 3-[(4-aminophenyl)sulfonyl-[6-(3,3-diphenylpropanoylamino)-1-hydroxyhexan-2-yl]amino]-2-methylpropanamide |
| SMILES | CC(CN(C(CO)CCCCNC(=O)CC(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(N)cc1)C(N)=O |
| InChI | InChI=1S/C31H40N4O5S/c1-23(31(33)38)21-35(41(39,40)28-17-15-26(32)16-18-28)27(22-36)14-8-9-19-34-30(37)20-29(24-10-4-2-5-11-24)25-12-6-3-7-13-25/h2-7,10-13,15-18,23,27,29,36H,8-9,14,19-22,32H2,1H3,(H2,33,38)(H,34,37) |
| InChIKey | LBZRUCAPNYSCRF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|