C36H48N4O6S — CID 78198185
N-[1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]oxolane-3-carboxamide (PubChem CID 78198185) has the molecular formula C36H48N4O6S and a molecular weight of 664.87 g/mol. Its IUPAC name is N-[1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]oxolane-3-carboxamide.
| Compound Name | N-[1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 78198185 |
| Molecular Formula | C36H48N4O6S |
| Molecular Weight | 664.87 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | N-[1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]oxolane-3-carboxamide |
| SMILES | CC(C)CN(C(CO)CCCCNC(=O)C(NC(=O)C1CCOC1)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C36H48N4O6S/c1-26(2)23-40(47(44,45)32-18-16-30(37)17-19-32)31(24-41)15-9-10-21-38-36(43)34(39-35(42)29-20-22-46-25-29)33(27-11-5-3-6-12-27)28-13-7-4-8-14-28/h3-8,11-14,16-19,26,29,31,33-34,41H,9-10,15,20-25,37H2,1-2H3,(H,38,43)(H,39,42) |
| InChIKey | GXAMUXGBSZYUEW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|