C32H41ClN4O6S — CID 172822931
[(2S)-1-[[(5S)-5-[(4-amino-3-chlorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid (PubChem CID 172822931) has the molecular formula C32H41ClN4O6S and a molecular weight of 645.22 g/mol. Its IUPAC name is [(2S)-1-[[(5S)-5-[(4-amino-3-chlorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[(5S)-5-[(4-amino-3-chlorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 172822931 |
| Molecular Formula | C32H41ClN4O6S |
| Molecular Weight | 645.22 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | [(2S)-1-[[(5S)-5-[(4-amino-3-chlorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@@H](NC(=O)O)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C32H41ClN4O6S/c1-22(2)20-37(44(42,43)26-16-17-28(34)27(33)19-26)25(21-38)15-9-10-18-35-31(39)30(36-32(40)41)29(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-8,11-14,16-17,19,22,25,29-30,36,38H,9-10,15,18,20-21,34H2,1-2H3,(H,35,39)(H,40,41)/t25-,30-/m0/s1 |
| InChIKey | ULUVCSKEEANCHF-QCDSWUKFSA-N |
| XLogP | 4.68 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|