C32H39F2N3O6S — CID 18009065
[1-[[5-[(2,4-difluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid (PubChem CID 18009065) has the molecular formula C32H39F2N3O6S and a molecular weight of 631.74 g/mol. Its IUPAC name is [1-[[5-[(2,4-difluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid.
| Compound Name | [1-[[5-[(2,4-difluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 18009065 |
| Molecular Formula | C32H39F2N3O6S |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | [1-[[5-[(2,4-difluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid |
| SMILES | CC(C)CN(C(CO)CCCCNC(=O)C(NC(=O)O)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C32H39F2N3O6S/c1-22(2)20-37(44(42,43)28-17-16-25(33)19-27(28)34)26(21-38)15-9-10-18-35-31(39)30(36-32(40)41)29(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-8,11-14,16-17,19,22,26,29-30,36,38H,9-10,15,18,20-21H2,1-2H3,(H,35,39)(H,40,41) |
| InChIKey | VUNMVGWFDWIKMD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|