C31H41FN4O4S — CID 513429
N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2-fluorophenyl)methyl]anilino]acetamide (PubChem CID 513429) has the molecular formula C31H41FN4O4S and a molecular weight of 584.76 g/mol. Its IUPAC name is N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2-fluorophenyl)methyl]anilino]acetamide.
| Compound Name | N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2-fluorophenyl)methyl]anilino]acetamide |
|---|---|
| PubChem CID | 513429 |
| Molecular Formula | C31H41FN4O4S |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2-fluorophenyl)methyl]anilino]acetamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)CN(Cc1ccccc1F)c1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C31H41FN4O4S/c1-24(2)20-36(41(39,40)29-17-15-26(33)16-18-29)28(23-37)13-8-9-19-34-31(38)22-35(27-11-4-3-5-12-27)21-25-10-6-7-14-30(25)32/h3-7,10-12,14-18,24,28,37H,8-9,13,19-23,33H2,1-2H3,(H,34,38)/t28-/m0/s1 |
| InChIKey | QIIKEDUNGZNOBB-NDEPHWFRSA-N |
| XLogP | 4.41 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|