C27H39N3O7S — CID 10145077
(2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2,4-dimethoxyphenyl)propanoylamino]hexanoic acid (PubChem CID 10145077) has the molecular formula C27H39N3O7S and a molecular weight of 549.69 g/mol. Its IUPAC name is (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2,4-dimethoxyphenyl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2,4-dimethoxyphenyl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 10145077 |
| Molecular Formula | C27H39N3O7S |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2,4-dimethoxyphenyl)propanoylamino]hexanoic acid |
| SMILES | COc1ccc(CCC(=O)NCCCC[C@@H](C(=O)O)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H39N3O7S/c1-19(2)18-30(38(34,35)23-13-10-21(28)11-14-23)24(27(32)33)7-5-6-16-29-26(31)15-9-20-8-12-22(36-3)17-25(20)37-4/h8,10-14,17,19,24H,5-7,9,15-16,18,28H2,1-4H3,(H,29,31)(H,32,33)/t24-/m0/s1 |
| InChIKey | HLNYGPUJDOAPJI-DEOSSOPVSA-N |
| XLogP | 3.31 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|