C28H36CsN3O5S — CID 23680338
cesium (2S)-6-[3-(1H-indol-3-yl)propanoylamino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate (PubChem CID 23680338) has the molecular formula C28H36CsN3O5S and a molecular weight of 659.58 g/mol. Its IUPAC name is cesium (2S)-6-[3-(1H-indol-3-yl)propanoylamino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate.
| Compound Name | cesium (2S)-6-[3-(1H-indol-3-yl)propanoylamino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate |
|---|---|
| PubChem CID | 23680338 |
| Molecular Formula | C28H36CsN3O5S |
| Molecular Weight | 659.58 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | cesium (2S)-6-[3-(1H-indol-3-yl)propanoylamino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(C)C)[C@@H](CCCCNC(=O)CCc2c[nH]c3ccccc23)C(=O)[O-])cc1.[Cs+] |
| InChI | InChI=1S/C28H37N3O5S.Cs/c1-20(2)19-31(37(35,36)23-14-11-21(3)12-15-23)26(28(33)34)10-6-7-17-29-27(32)16-13-22-18-30-25-9-5-4-8-24(22)25;/h4-5,8-9,11-12,14-15,18,20,26,30H,6-7,10,13,16-17,19H2,1-3H3,(H,29,32)(H,33,34);/q;+1/p-1/t26-;/m0./s1 |
| InChIKey | HQFIZFMPAVDUHQ-SNYZSRNZSA-M |
| XLogP | 0.16 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.58 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|