C36H44N6O6S2 — CID 508624
(2S)-6-[[(2S)-1-(cyanoamino)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propylidene]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid (PubChem CID 508624) has the molecular formula C36H44N6O6S2 and a molecular weight of 720.92 g/mol. Its IUPAC name is (2S)-6-[[(2S)-1-(cyanoamino)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propylidene]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid.
| Compound Name | (2S)-6-[[(2S)-1-(cyanoamino)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propylidene]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 508624 |
| Molecular Formula | C36H44N6O6S2 |
| Molecular Weight | 720.92 g/mol |
| Exact Mass | 720.28 |
| IUPAC Name | (2S)-6-[[(2S)-1-(cyanoamino)-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]propylidene]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2c[nH]c3ccccc23)/C(=N/CCCC[C@@H](C(=O)O)N(CC(C)C)S(=O)(=O)c2ccc(C)cc2)NC#N)cc1 |
| InChI | InChI=1S/C36H44N6O6S2/c1-25(2)23-42(50(47,48)30-18-14-27(4)15-19-30)34(36(43)44)11-7-8-20-38-35(40-24-37)33(21-28-22-39-32-10-6-5-9-31(28)32)41-49(45,46)29-16-12-26(3)13-17-29/h5-6,9-10,12-19,22,25,33-34,39,41H,7-8,11,20-21,23H2,1-4H3,(H,38,40)(H,43,44)/t33-,34-/m0/s1 |
| InChIKey | MUDDHKLDTOEFRC-HEVIKAOCSA-N |
| XLogP | 5.11 |
| TPSA | 184.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|