C31H35CsN2O6S — CID 23664282
cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-(9H-xanthene-9-carbonylamino)hexanoate (PubChem CID 23664282) has the molecular formula C31H35CsN2O6S and a molecular weight of 696.60 g/mol. Its IUPAC name is cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-(9H-xanthene-9-carbonylamino)hexanoate.
| Compound Name | cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-(9H-xanthene-9-carbonylamino)hexanoate |
|---|---|
| PubChem CID | 23664282 |
| Molecular Formula | C31H35CsN2O6S |
| Molecular Weight | 696.60 g/mol |
| Exact Mass | 696.13 |
| IUPAC Name | cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-(9H-xanthene-9-carbonylamino)hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(C)C)[C@@H](CCCCNC(=O)C2c3ccccc3Oc3ccccc32)C(=O)[O-])cc1.[Cs+] |
| InChI | InChI=1S/C31H36N2O6S.Cs/c1-21(2)20-33(40(37,38)23-17-15-22(3)16-18-23)26(31(35)36)12-8-9-19-32-30(34)29-24-10-4-6-13-27(24)39-28-14-7-5-11-25(28)29;/h4-7,10-11,13-18,21,26,29H,8-9,12,19-20H2,1-3H3,(H,32,34)(H,35,36);/q;+1/p-1/t26-;/m0./s1 |
| InChIKey | VLHRJPVCEAZAHU-SNYZSRNZSA-M |
| XLogP | 0.99 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.60 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|