C26H36N3NaO6S — CID 23667960
sodium (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2-methoxyphenyl)propanoylamino]hexanoate (PubChem CID 23667960) has the molecular formula C26H36N3NaO6S and a molecular weight of 541.65 g/mol. Its IUPAC name is sodium (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2-methoxyphenyl)propanoylamino]hexanoate.
| Compound Name | sodium (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2-methoxyphenyl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 23667960 |
| Molecular Formula | C26H36N3NaO6S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | sodium (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[3-(2-methoxyphenyl)propanoylamino]hexanoate |
| SMILES | COc1ccccc1CCC(=O)NCCCC[C@@H](C(=O)[O-])N(CC(C)C)S(=O)(=O)c1ccc(N)cc1.[Na+] |
| InChI | InChI=1S/C26H37N3O6S.Na/c1-19(2)18-29(36(33,34)22-14-12-21(27)13-15-22)23(26(31)32)9-6-7-17-28-25(30)16-11-20-8-4-5-10-24(20)35-3;/h4-5,8,10,12-15,19,23H,6-7,9,11,16-18,27H2,1-3H3,(H,28,30)(H,31,32);/q;+1/p-1/t23-;/m0./s1 |
| InChIKey | PUWRPSZSEHNWHP-BQAIUKQQSA-M |
| XLogP | -1.03 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|