C34H47N5O8PS+ — CID 68654486
[2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(morpholine-4-carbonylamino)-3-naphthalen-1-ylpropanoyl]amino]hexoxy]-hydroxy-oxophosphanium (PubChem CID 68654486) has the molecular formula C34H47N5O8PS+ and a molecular weight of 716.82 g/mol. Its IUPAC name is [2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(morpholine-4-carbonylamino)-3-naphthalen-1-ylpropanoyl]amino]hexoxy]-hydroxy-oxophosphanium.
| Compound Name | [2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(morpholine-4-carbonylamino)-3-naphthalen-1-ylpropanoyl]amino]hexoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 68654486 |
| Molecular Formula | C34H47N5O8PS+ |
| Molecular Weight | 716.82 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | [2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(morpholine-4-carbonylamino)-3-naphthalen-1-ylpropanoyl]amino]hexoxy]-hydroxy-oxophosphanium |
| SMILES | CC(C)CN(C(CCCCNC(=O)C(Cc1cccc2ccccc12)NC(=O)N1CCOCC1)CO[P+](=O)O)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H46N5O8PS/c1-25(2)23-39(49(44,45)30-15-13-28(35)14-16-30)29(24-47-48(42)43)11-5-6-17-36-33(40)32(37-34(41)38-18-20-46-21-19-38)22-27-10-7-9-26-8-3-4-12-31(26)27/h3-4,7-10,12-16,25,29,32H,5-6,11,17-24,35H2,1-2H3,(H2-,36,37,40,41,42,43)/p+1 |
| InChIKey | BFLUWEZOUYJRQQ-UHFFFAOYSA-O |
| XLogP | 4.04 |
| TPSA | 180.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|