C34H47N5O6S — CID 513955
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 513955) has the molecular formula C34H47N5O6S and a molecular weight of 653.85 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 513955 |
| Molecular Formula | C34H47N5O6S |
| Molecular Weight | 653.85 g/mol |
| Exact Mass | 653.32 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)N1CCOCC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H47N5O6S/c1-25(2)23-39(46(43,44)31-14-12-29(35)13-15-31)30(24-40)9-5-6-16-36-33(41)32(37-34(42)38-17-19-45-20-18-38)22-26-10-11-27-7-3-4-8-28(27)21-26/h3-4,7-8,10-15,21,25,30,32,40H,5-6,9,16-20,22-24,35H2,1-2H3,(H,36,41)(H,37,42)/t30-,32-/m0/s1 |
| InChIKey | QDGXVVYQVDKYGK-CDZUIXILSA-N |
| XLogP | 3.37 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|