C21H15N2O5- — CID 8699879
4-nitro-2-[(9H-xanthene-9-carbonylamino)methyl]phenolate (PubChem CID 8699879) has the molecular formula C21H15N2O5- and a molecular weight of 375.36 g/mol. Its IUPAC name is 4-nitro-2-[(9H-xanthene-9-carbonylamino)methyl]phenolate.
| Compound Name | 4-nitro-2-[(9H-xanthene-9-carbonylamino)methyl]phenolate |
|---|---|
| PubChem CID | 8699879 |
| Molecular Formula | C21H15N2O5- |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-nitro-2-[(9H-xanthene-9-carbonylamino)methyl]phenolate |
| SMILES | O=C(NCc1cc([N+](=O)[O-])ccc1[O-])C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C21H16N2O5/c24-17-10-9-14(23(26)27)11-13(17)12-22-21(25)20-15-5-1-3-7-18(15)28-19-8-4-2-6-16(19)20/h1-11,20,24H,12H2,(H,22,25)/p-1 |
| InChIKey | RVFXBDPPEXEIMR-UHFFFAOYSA-M |
| XLogP | 3.22 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|