C21H18N2O5 — CID 24818295
N-[(2-hydroxy-5-nitrophenyl)methyl]-4-(phenoxymethyl)benzamide (PubChem CID 24818295) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[(2-hydroxy-5-nitrophenyl)methyl]-4-(phenoxymethyl)benzamide.
| Compound Name | N-[(2-hydroxy-5-nitrophenyl)methyl]-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 24818295 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(2-hydroxy-5-nitrophenyl)methyl]-4-(phenoxymethyl)benzamide |
| SMILES | O=C(NCc1cc([N+](=O)[O-])ccc1O)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2O5/c24-20-11-10-18(23(26)27)12-17(20)13-22-21(25)16-8-6-15(7-9-16)14-28-19-4-2-1-3-5-19/h1-12,24H,13-14H2,(H,22,25) |
| InChIKey | ZYSHYUDNGIPRBJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|