C22H23N2O3+ — CID 2550517
[(1R)-1-(furan-2-yl)-2-(9H-xanthene-9-carbonylamino)ethyl]-dimethylazanium (PubChem CID 2550517) has the molecular formula C22H23N2O3+ and a molecular weight of 363.44 g/mol. Its IUPAC name is [(1R)-1-(furan-2-yl)-2-(9H-xanthene-9-carbonylamino)ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(furan-2-yl)-2-(9H-xanthene-9-carbonylamino)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2550517 |
| Molecular Formula | C22H23N2O3+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [(1R)-1-(furan-2-yl)-2-(9H-xanthene-9-carbonylamino)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CNC(=O)C1c2ccccc2Oc2ccccc21)c1ccco1 |
| InChI | InChI=1S/C22H22N2O3/c1-24(2)17(20-12-7-13-26-20)14-23-22(25)21-15-8-3-5-10-18(15)27-19-11-6-4-9-16(19)21/h3-13,17,21H,14H2,1-2H3,(H,23,25)/p+1/t17-/m1/s1 |
| InChIKey | NIJIYSZTAHLMHF-QGZVFWFLSA-O |
| XLogP | 2.52 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |