C19H26N3O3+ — CID 2530415
[(1R)-2-[[(3R)-3-acetamido-3-phenylpropanoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 2530415) has the molecular formula C19H26N3O3+ and a molecular weight of 344.44 g/mol. Its IUPAC name is [(1R)-2-[[(3R)-3-acetamido-3-phenylpropanoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[[(3R)-3-acetamido-3-phenylpropanoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2530415 |
| Molecular Formula | C19H26N3O3+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(1R)-2-[[(3R)-3-acetamido-3-phenylpropanoyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | CC(=O)N[C@H](CC(=O)NC[C@H](c1ccco1)[NH+](C)C)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O3/c1-14(23)21-16(15-8-5-4-6-9-15)12-19(24)20-13-17(22(2)3)18-10-7-11-25-18/h4-11,16-17H,12-13H2,1-3H3,(H,20,24)(H,21,23)/p+1/t16-,17-/m1/s1 |
| InChIKey | INGNDLJQKMEYPE-IAGOWNOFSA-O |
| XLogP | 0.85 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |