C31H34N2O5S — CID 10165989
N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-2-(2-phenylethyl)benzamide (PubChem CID 10165989) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 10165989 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-2-(2-phenylethyl)benzamide |
| SMILES | CC#CCOc1ccc(S(=O)C(CCCCNC(=O)c2ccccc2CCc2ccccc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C31H34N2O5S/c1-2-3-23-38-26-18-20-27(21-19-26)39(37)29(31(35)33-36)15-9-10-22-32-30(34)28-14-8-7-13-25(28)17-16-24-11-5-4-6-12-24/h4-8,11-14,18-21,29,36H,9-10,15-17,22-23H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | HYLFDNGCOWLWAO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|