C16H20N2O5S — CID 22633945
2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxyhexanediamide (PubChem CID 22633945) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxyhexanediamide.
| Compound Name | 2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxyhexanediamide |
|---|---|
| PubChem CID | 22633945 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxyhexanediamide |
| SMILES | CC#CCOc1ccc(S(=O)C(CCCC(N)=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-2-3-11-23-12-7-9-13(10-8-12)24(22)14(16(20)18-21)5-4-6-15(17)19/h7-10,14,21H,4-6,11H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | MNHBZMCUSMORBA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|