C18H17NO3S — CID 10268288
2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-phenylacetamide (PubChem CID 10268288) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 10268288 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-phenylacetamide |
| SMILES | CC#CCOc1ccc(SC(C(=O)NO)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-2-3-13-22-15-9-11-16(12-10-15)23-17(18(20)19-21)14-7-5-4-6-8-14/h4-12,17,21H,13H2,1H3,(H,19,20) |
| InChIKey | CDIBBFPULKXHGN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|