C22H19NO3S2 — CID 142651595
(2R)-2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-(4-thiophen-2-ylphenyl)acetamide (PubChem CID 142651595) has the molecular formula C22H19NO3S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2R)-2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-(4-thiophen-2-ylphenyl)acetamide.
| Compound Name | (2R)-2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-(4-thiophen-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 142651595 |
| Molecular Formula | C22H19NO3S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (2R)-2-(4-but-2-ynoxyphenyl)sulfanyl-N-hydroxy-2-(4-thiophen-2-ylphenyl)acetamide |
| SMILES | CC#CCOc1ccc(S[C@@H](C(=O)NO)c2ccc(-c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C22H19NO3S2/c1-2-3-14-26-18-10-12-19(13-11-18)28-21(22(24)23-25)17-8-6-16(7-9-17)20-5-4-15-27-20/h4-13,15,21,25H,14H2,1H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | OWZZXAHEAAOPBJ-OAQYLSRUSA-N |
| XLogP | 5.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|