C30H26N2O5S — CID 22785382
2-[[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 22785382) has the molecular formula C30H26N2O5S and a molecular weight of 526.61 g/mol. Its IUPAC name is 2-[[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22785382 |
| Molecular Formula | C30H26N2O5S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 2-[[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCOc1ccc(NC(=O)C(Sc2ccc(NC(=O)c3ccccc3C(=O)O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N2O5S/c1-2-37-23-16-12-21(13-17-23)32-29(34)27(20-8-4-3-5-9-20)38-24-18-14-22(15-19-24)31-28(33)25-10-6-7-11-26(25)30(35)36/h3-19,27H,2H2,1H3,(H,31,33)(H,32,34)(H,35,36) |
| InChIKey | UOUVRLXTEQNVIN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |