C21H20N4O5S2 — CID 23967481
2-[[5-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid (PubChem CID 23967481) has the molecular formula C21H20N4O5S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[[5-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[5-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 23967481 |
| Molecular Formula | C21H20N4O5S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 2-[[5-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid |
| SMILES | CCOc1ccc(NC(=O)C(C)Sc2nnc(NC(=O)c3ccccc3C(=O)O)s2)cc1 |
| InChI | InChI=1S/C21H20N4O5S2/c1-3-30-14-10-8-13(9-11-14)22-17(26)12(2)31-21-25-24-20(32-21)23-18(27)15-6-4-5-7-16(15)19(28)29/h4-12H,3H2,1-2H3,(H,22,26)(H,28,29)(H,23,24,27) |
| InChIKey | BBCPFWJSIMGVJV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|