C29H32N2O3S — CID 23098886
N-[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide (PubChem CID 23098886) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 23098886 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-[4-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide |
| SMILES | CCOc1ccc(NC(=O)C(Sc2ccc(NC(=O)C3CCCCC3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N2O3S/c1-2-34-25-17-13-23(14-18-25)31-29(33)27(21-9-5-3-6-10-21)35-26-19-15-24(16-20-26)30-28(32)22-11-7-4-8-12-22/h3,5-6,9-10,13-20,22,27H,2,4,7-8,11-12H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | ZGQZWXNEBVFDSD-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |