C27H27FN2O2S — CID 23095705
N-[4-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide (PubChem CID 23095705) has the molecular formula C27H27FN2O2S and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[4-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 23095705 |
| Molecular Formula | C27H27FN2O2S |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[4-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(F)cc2)c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H27FN2O2S/c28-21-11-13-22(14-12-21)30-27(32)25(19-7-3-1-4-8-19)33-24-17-15-23(16-18-24)29-26(31)20-9-5-2-6-10-20/h1,3-4,7-8,11-18,20,25H,2,5-6,9-10H2,(H,29,31)(H,30,32) |
| InChIKey | OGOSJXKYLIEPHB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |