C33H30N2O7S — CID 18896675
4-[[3-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 18896675) has the molecular formula C33H30N2O7S and a molecular weight of 598.68 g/mol. Its IUPAC name is 4-[[3-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[3-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18896675 |
| Molecular Formula | C33H30N2O7S |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 4-[[3-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | CCCCOc1ccc(NC(=O)C(Sc2cccc(NC(=O)c3ccc(C(=O)O)cc3C(=O)O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30N2O7S/c1-2-3-18-42-25-15-13-23(14-16-25)34-31(37)29(21-8-5-4-6-9-21)43-26-11-7-10-24(20-26)35-30(36)27-17-12-22(32(38)39)19-28(27)33(40)41/h4-17,19-20,29H,2-3,18H2,1H3,(H,34,37)(H,35,36)(H,38,39)(H,40,41) |
| InChIKey | HUNMRWGYMLSKMH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|