C33H37N3O5S — CID 10167311
N-[2-[[5-(4-but-2-ynoxyphenyl)sulfanyl-6-(hydroxyamino)-6-oxohexyl]amino]-2-oxoethyl]-2-(2-phenylethyl)benzamide (PubChem CID 10167311) has the molecular formula C33H37N3O5S and a molecular weight of 587.74 g/mol. Its IUPAC name is N-[2-[[5-(4-but-2-ynoxyphenyl)sulfanyl-6-(hydroxyamino)-6-oxohexyl]amino]-2-oxoethyl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[2-[[5-(4-but-2-ynoxyphenyl)sulfanyl-6-(hydroxyamino)-6-oxohexyl]amino]-2-oxoethyl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 10167311 |
| Molecular Formula | C33H37N3O5S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | N-[2-[[5-(4-but-2-ynoxyphenyl)sulfanyl-6-(hydroxyamino)-6-oxohexyl]amino]-2-oxoethyl]-2-(2-phenylethyl)benzamide |
| SMILES | CC#CCOc1ccc(SC(CCCCNC(=O)CNC(=O)c2ccccc2CCc2ccccc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C33H37N3O5S/c1-2-3-23-41-27-18-20-28(21-19-27)42-30(33(39)36-40)15-9-10-22-34-31(37)24-35-32(38)29-14-8-7-13-26(29)17-16-25-11-5-4-6-12-25/h4-8,11-14,18-21,30,40H,9-10,15-17,22-24H2,1H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | AFDWOSHMSGYFOO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|