C18H26N2O3 — CID 23660155
N-(4,4-diethoxybutyl)-2-(1H-indol-3-yl)acetamide (PubChem CID 23660155) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(4,4-diethoxybutyl)-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-(4,4-diethoxybutyl)-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 23660155 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-(4,4-diethoxybutyl)-2-(1H-indol-3-yl)acetamide |
| SMILES | CCOC(CCCNC(=O)Cc1c[nH]c2ccccc12)OCC |
| InChI | InChI=1S/C18H26N2O3/c1-3-22-18(23-4-2)10-7-11-19-17(21)12-14-13-20-16-9-6-5-8-15(14)16/h5-6,8-9,13,18,20H,3-4,7,10-12H2,1-2H3,(H,19,21) |
| InChIKey | VIDVCCNHKFHOIX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|