C14H19NO2 — CID 13270992
3-(2,2-diethoxyethyl)-1H-indole (PubChem CID 13270992) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(2,2-diethoxyethyl)-1H-indole.
| Compound Name | 3-(2,2-diethoxyethyl)-1H-indole |
|---|---|
| PubChem CID | 13270992 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-(2,2-diethoxyethyl)-1H-indole |
| SMILES | CCOC(Cc1c[nH]c2ccccc12)OCC |
| InChI | InChI=1S/C14H19NO2/c1-3-16-14(17-4-2)9-11-10-15-13-8-6-5-7-12(11)13/h5-8,10,14-15H,3-4,9H2,1-2H3 |
| InChIKey | UWUYCRGAVBRCRQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|