C16H20O2 — CID 146004800
1-(2,2-diethoxyethyl)naphthalene (PubChem CID 146004800) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)naphthalene.
| Compound Name | 1-(2,2-diethoxyethyl)naphthalene |
|---|---|
| PubChem CID | 146004800 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1-(2,2-diethoxyethyl)naphthalene |
| SMILES | CCOC(Cc1cccc2ccccc12)OCC |
| InChI | InChI=1S/C16H20O2/c1-3-17-16(18-4-2)12-14-10-7-9-13-8-5-6-11-15(13)14/h5-11,16H,3-4,12H2,1-2H3 |
| InChIKey | NCPFASHJFPXPLQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|