C17H23N — CID 62678617
3,3-dimethyl-1-naphthalen-1-ylpentan-2-amine (PubChem CID 62678617) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-naphthalen-1-ylpentan-2-amine.
| Compound Name | 3,3-dimethyl-1-naphthalen-1-ylpentan-2-amine |
|---|---|
| PubChem CID | 62678617 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3,3-dimethyl-1-naphthalen-1-ylpentan-2-amine |
| SMILES | CCC(C)(C)C(N)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C17H23N/c1-4-17(2,3)16(18)12-14-10-7-9-13-8-5-6-11-15(13)14/h5-11,16H,4,12,18H2,1-3H3 |
| InChIKey | AFMSOXMBLGWACW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |