C22H26N2O3 — CID 11748904
N-[1,1-diethoxy-3-(1H-indol-3-yl)propan-2-yl]benzamide (PubChem CID 11748904) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[1,1-diethoxy-3-(1H-indol-3-yl)propan-2-yl]benzamide.
| Compound Name | N-[1,1-diethoxy-3-(1H-indol-3-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 11748904 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[1,1-diethoxy-3-(1H-indol-3-yl)propan-2-yl]benzamide |
| SMILES | CCOC(OCC)C(Cc1c[nH]c2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c1-3-26-22(27-4-2)20(24-21(25)16-10-6-5-7-11-16)14-17-15-23-19-13-9-8-12-18(17)19/h5-13,15,20,22-23H,3-4,14H2,1-2H3,(H,24,25) |
| InChIKey | HTDDVXXUMKNCLX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|