C20H18N4O2 — CID 87849413
N-[(2S)-1-[cyano(methyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide (PubChem CID 87849413) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[(2S)-1-[cyano(methyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[cyano(methyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 87849413 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(2S)-1-[cyano(methyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide |
| SMILES | CN(C#N)C(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18N4O2/c1-24(13-21)20(26)18(23-19(25)14-7-3-2-4-8-14)11-15-12-22-17-10-6-5-9-16(15)17/h2-10,12,18,22H,11H2,1H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | SWKFLDFQMFHLPJ-SFHVURJKSA-N |
| XLogP | 2.45 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|