C22H21ClN4O2 — CID 87927546
3-(chloromethyl)-N-[1-[cyano(ethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide (PubChem CID 87927546) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 3-(chloromethyl)-N-[1-[cyano(ethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide.
| Compound Name | 3-(chloromethyl)-N-[1-[cyano(ethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 87927546 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-(chloromethyl)-N-[1-[cyano(ethyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide |
| SMILES | CCN(C#N)C(=O)C(Cc1c[nH]c2ccccc12)NC(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C22H21ClN4O2/c1-2-27(14-24)22(29)20(11-17-13-25-19-9-4-3-8-18(17)19)26-21(28)16-7-5-6-15(10-16)12-23/h3-10,13,20,25H,2,11-12H2,1H3,(H,26,28) |
| InChIKey | NZLXKQCBVXZUIS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|