C14H21ClFNO2S — CID 166176148
[4-[(4-fluorophenyl)sulfonylmethyl]cyclohexyl]methanamine;hydrochloride (PubChem CID 166176148) has the molecular formula C14H21ClFNO2S and a molecular weight of 321.84 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)sulfonylmethyl]cyclohexyl]methanamine;hydrochloride.
| Compound Name | [4-[(4-fluorophenyl)sulfonylmethyl]cyclohexyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 166176148 |
| Molecular Formula | C14H21ClFNO2S |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [4-[(4-fluorophenyl)sulfonylmethyl]cyclohexyl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCC(CS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H20FNO2S.ClH/c15-13-5-7-14(8-6-13)19(17,18)10-12-3-1-11(9-16)2-4-12;/h5-8,11-12H,1-4,9-10,16H2;1H |
| InChIKey | CRQBBSHMMCRRCR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |