C19H20F2O3S — CID 58344321
[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]methanol (PubChem CID 58344321) has the molecular formula C19H20F2O3S and a molecular weight of 366.43 g/mol. Its IUPAC name is [3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]methanol.
| Compound Name | [3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 58344321 |
| Molecular Formula | C19H20F2O3S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]methanol |
| SMILES | O=S(=O)(CC1CCC(CO)C1)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H20F2O3S/c20-16-5-8-18(19(21)10-16)15-3-6-17(7-4-15)25(23,24)12-14-2-1-13(9-14)11-22/h3-8,10,13-14,22H,1-2,9,11-12H2 |
| InChIKey | WLSLDFJXQXNQRD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |