C21H25F2NO2S — CID 58344130
4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]-N-ethylcyclohexan-1-amine (PubChem CID 58344130) has the molecular formula C21H25F2NO2S and a molecular weight of 393.50 g/mol. Its IUPAC name is 4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]-N-ethylcyclohexan-1-amine.
| Compound Name | 4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]-N-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 58344130 |
| Molecular Formula | C21H25F2NO2S |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]-N-ethylcyclohexan-1-amine |
| SMILES | CCNC1CCC(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C21H25F2NO2S/c1-2-24-18-8-3-15(4-9-18)14-27(25,26)19-10-5-16(6-11-19)20-12-7-17(22)13-21(20)23/h5-7,10-13,15,18,24H,2-4,8-9,14H2,1H3 |
| InChIKey | VOJRFABWLYDRJN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |