C19H20ClFO3S — CID 58344117
4-[[4-(4-chloro-2-fluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol (PubChem CID 58344117) has the molecular formula C19H20ClFO3S and a molecular weight of 382.88 g/mol. Its IUPAC name is 4-[[4-(4-chloro-2-fluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol.
| Compound Name | 4-[[4-(4-chloro-2-fluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 58344117 |
| Molecular Formula | C19H20ClFO3S |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-[[4-(4-chloro-2-fluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol |
| SMILES | O=S(=O)(CC1CCC(O)CC1)c1ccc(-c2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H20ClFO3S/c20-15-5-10-18(19(21)11-15)14-3-8-17(9-4-14)25(23,24)12-13-1-6-16(22)7-2-13/h3-5,8-11,13,16,22H,1-2,6-7,12H2 |
| InChIKey | IZSYECUWWFEYFV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |