C23H27F2NO3S — CID 58344182
4-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]morpholine (PubChem CID 58344182) has the molecular formula C23H27F2NO3S and a molecular weight of 435.54 g/mol. Its IUPAC name is 4-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]morpholine.
| Compound Name | 4-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]morpholine |
|---|---|
| PubChem CID | 58344182 |
| Molecular Formula | C23H27F2NO3S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]morpholine |
| SMILES | O=S(=O)(CC1CCC(N2CCOCC2)CC1)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C23H27F2NO3S/c24-19-5-10-22(23(25)15-19)18-3-8-21(9-4-18)30(27,28)16-17-1-6-20(7-2-17)26-11-13-29-14-12-26/h3-5,8-10,15,17,20H,1-2,6-7,11-14,16H2 |
| InChIKey | FIIFGRYREIWZRP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |