C18H18F2O3S — CID 58344310
(1R)-3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentan-1-ol (PubChem CID 58344310) has the molecular formula C18H18F2O3S and a molecular weight of 352.40 g/mol. Its IUPAC name is (1R)-3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentan-1-ol.
| Compound Name | (1R)-3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 58344310 |
| Molecular Formula | C18H18F2O3S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (1R)-3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentan-1-ol |
| SMILES | O=S(=O)(CC1CC[C@@H](O)C1)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H18F2O3S/c19-14-4-8-17(18(20)10-14)13-2-6-16(7-3-13)24(22,23)11-12-1-5-15(21)9-12/h2-4,6-8,10,12,15,21H,1,5,9,11H2/t12?,15-/m1/s1 |
| InChIKey | MRBHDPWMWRPPKA-WPZCJLIBSA-N |
| XLogP | 3.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |