C18H21F2NO3S — CID 143959250
N-cyclopentyl-4-(2,4-difluorophenyl)benzenesulfonamide;methanol (PubChem CID 143959250) has the molecular formula C18H21F2NO3S and a molecular weight of 369.43 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,4-difluorophenyl)benzenesulfonamide;methanol.
| Compound Name | N-cyclopentyl-4-(2,4-difluorophenyl)benzenesulfonamide;methanol |
|---|---|
| PubChem CID | 143959250 |
| Molecular Formula | C18H21F2NO3S |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-cyclopentyl-4-(2,4-difluorophenyl)benzenesulfonamide;methanol |
| SMILES | CO.O=S(=O)(NC1CCCC1)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H17F2NO2S.CH4O/c18-13-7-10-16(17(19)11-13)12-5-8-15(9-6-12)23(21,22)20-14-3-1-2-4-14;1-2/h5-11,14,20H,1-4H2;2H,1H3 |
| InChIKey | FRBDMBWWGODCSF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |