C28H31F2N2O4S+ — CID 91160410
[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]cyclohexyl]-[(2,4-dimethoxyphenyl)methyl]-methylideneazanium (PubChem CID 91160410) has the molecular formula C28H31F2N2O4S+ and a molecular weight of 529.63 g/mol. Its IUPAC name is [4-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]cyclohexyl]-[(2,4-dimethoxyphenyl)methyl]-methylideneazanium.
| Compound Name | [4-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]cyclohexyl]-[(2,4-dimethoxyphenyl)methyl]-methylideneazanium |
|---|---|
| PubChem CID | 91160410 |
| Molecular Formula | C28H31F2N2O4S+ |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [4-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]cyclohexyl]-[(2,4-dimethoxyphenyl)methyl]-methylideneazanium |
| SMILES | C=[N+](Cc1ccc(OC)cc1OC)C1CCC(NS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C28H31F2N2O4S/c1-32(18-20-4-12-24(35-2)17-28(20)36-3)23-10-8-22(9-11-23)31-37(33,34)25-13-5-19(6-14-25)26-15-7-21(29)16-27(26)30/h4-7,12-17,22-23,31H,1,8-11,18H2,2-3H3/q+1 |
| InChIKey | APPPMJIVFXSHPC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|