C18H17F2NO3S — CID 45279229
4-(2,4-difluorophenyl)-N-(4-oxocyclohexyl)benzenesulfonamide (PubChem CID 45279229) has the molecular formula C18H17F2NO3S and a molecular weight of 365.40 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-(4-oxocyclohexyl)benzenesulfonamide.
| Compound Name | 4-(2,4-difluorophenyl)-N-(4-oxocyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 45279229 |
| Molecular Formula | C18H17F2NO3S |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-(4-oxocyclohexyl)benzenesulfonamide |
| SMILES | O=C1CCC(NS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C18H17F2NO3S/c19-13-3-10-17(18(20)11-13)12-1-8-16(9-2-12)25(23,24)21-14-4-6-15(22)7-5-14/h1-3,8-11,14,21H,4-7H2 |
| InChIKey | DHFCTLFZTLRZAU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |