C18H19NO3S — CID 67130795
N-(4-oxocyclohexyl)-4-phenylbenzenesulfonamide (PubChem CID 67130795) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-(4-oxocyclohexyl)-4-phenylbenzenesulfonamide.
| Compound Name | N-(4-oxocyclohexyl)-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 67130795 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-(4-oxocyclohexyl)-4-phenylbenzenesulfonamide |
| SMILES | O=C1CCC(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C18H19NO3S/c20-17-10-8-16(9-11-17)19-23(21,22)18-12-6-15(7-13-18)14-4-2-1-3-5-14/h1-7,12-13,16,19H,8-11H2 |
| InChIKey | ALIIRMIXJUXYNN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |