C26H34F2N2O2S — CID 129013703
4-(2,4-difluorophenyl)-N-[4-(4-pyrrolidin-1-ylbutyl)cyclohexyl]benzenesulfonamide (PubChem CID 129013703) has the molecular formula C26H34F2N2O2S and a molecular weight of 476.63 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-[4-(4-pyrrolidin-1-ylbutyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-(2,4-difluorophenyl)-N-[4-(4-pyrrolidin-1-ylbutyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 129013703 |
| Molecular Formula | C26H34F2N2O2S |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-[4-(4-pyrrolidin-1-ylbutyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCC(CCCCN2CCCC2)CC1)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C26H34F2N2O2S/c27-22-10-15-25(26(28)19-22)21-8-13-24(14-9-21)33(31,32)29-23-11-6-20(7-12-23)5-1-2-16-30-17-3-4-18-30/h8-10,13-15,19-20,23,29H,1-7,11-12,16-18H2 |
| InChIKey | RFVYDTRYAFXQKE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|