C24H29FO4S — CID 58291969
(3S)-3-(4-fluorophenyl)-1-[4-[(4-methoxyphenyl)sulfonylmethyl]cyclohexyl]butan-1-one (PubChem CID 58291969) has the molecular formula C24H29FO4S and a molecular weight of 432.56 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-1-[4-[(4-methoxyphenyl)sulfonylmethyl]cyclohexyl]butan-1-one.
| Compound Name | (3S)-3-(4-fluorophenyl)-1-[4-[(4-methoxyphenyl)sulfonylmethyl]cyclohexyl]butan-1-one |
|---|---|
| PubChem CID | 58291969 |
| Molecular Formula | C24H29FO4S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-1-[4-[(4-methoxyphenyl)sulfonylmethyl]cyclohexyl]butan-1-one |
| SMILES | COc1ccc(S(=O)(=O)CC2CCC(C(=O)C[C@H](C)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H29FO4S/c1-17(19-7-9-21(25)10-8-19)15-24(26)20-5-3-18(4-6-20)16-30(27,28)23-13-11-22(29-2)12-14-23/h7-14,17-18,20H,3-6,15-16H2,1-2H3/t17-,18?,20?/m0/s1 |
| InChIKey | AXRQPBGCQCXSDH-ZJRDLVKKSA-N |
| XLogP | 5.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |