C11H12BrFO3S — CID 86750318
(2R,4R)-4-bromo-2-[(4-fluorophenyl)sulfonylmethyl]oxolane (PubChem CID 86750318) has the molecular formula C11H12BrFO3S and a molecular weight of 323.18 g/mol. Its IUPAC name is (2R,4R)-4-bromo-2-[(4-fluorophenyl)sulfonylmethyl]oxolane.
| Compound Name | (2R,4R)-4-bromo-2-[(4-fluorophenyl)sulfonylmethyl]oxolane |
|---|---|
| PubChem CID | 86750318 |
| Molecular Formula | C11H12BrFO3S |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | (2R,4R)-4-bromo-2-[(4-fluorophenyl)sulfonylmethyl]oxolane |
| SMILES | O=S(=O)(C[C@H]1C[C@@H](Br)CO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12BrFO3S/c12-8-5-10(16-6-8)7-17(14,15)11-3-1-9(13)2-4-11/h1-4,8,10H,5-7H2/t8-,10-/m1/s1 |
| InChIKey | JCLGIRTXRMCPFP-PSASIEDQSA-N |
| XLogP | 2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|