C14H20O3S — CID 102328367
(2S,4S)-2-(benzenesulfonylmethyl)-4-propyloxolane (PubChem CID 102328367) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is (2S,4S)-2-(benzenesulfonylmethyl)-4-propyloxolane.
| Compound Name | (2S,4S)-2-(benzenesulfonylmethyl)-4-propyloxolane |
|---|---|
| PubChem CID | 102328367 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2S,4S)-2-(benzenesulfonylmethyl)-4-propyloxolane |
| SMILES | CCC[C@@H]1CO[C@H](CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C14H20O3S/c1-2-6-12-9-13(17-10-12)11-18(15,16)14-7-4-3-5-8-14/h3-5,7-8,12-13H,2,6,9-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | WLJSZFSARLMPPC-STQMWFEESA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |